2-Amino-[1,8]naphthyridine-3-carbonitrile
Catalog No: FT-0677574
CAS No: 15935-95-2
- Chemical Name: 2-Amino-[1,8]naphthyridine-3-carbonitrile
- Molecular Formula: C9H6N4
- Molecular Weight: 170.17
- InChI Key: OAKUSQCSHYQNHJ-UHFFFAOYSA-N
- InChI: InChI=1S/C9H6N4/c10-5-7-4-6-2-1-3-12-9(6)13-8(7)11/h1-4H,(H2,11,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 170.17100 |
| Density: | 1.37g/cm3 |
| CAS: | 15935-95-2 |
| Bolling_Point: | 407ºC at 760mmHg |
| Product_Name: | 2-Amino-[1,8]naphthyridine-3-carbonitrile |
| Melting_Point: | N/A |
| Flash_Point: | 200ºC |
| MF: | C9H6N4 |
| Density: | 1.37g/cm3 |
|---|---|
| LogP: | 1.66488 |
| Flash_Point: | 200ºC |
| Refractive_Index: | 1.706 |
| FW: | 170.17100 |
| PSA: | 75.59000 |
| MF: | C9H6N4 |
| Bolling_Point: | 407ºC at 760mmHg |
| Vapor_Pressure: | 7.77E-07mmHg at 25°C |
| Exact_Mass: | 170.05900 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)